C21H41N3O8 — CID 118883340
(2R,5R)-2-[(1S,3R,4S)-2-amino-5-[(2R,6R)-3-amino-6-ethyloxan-2-yl]oxy-3,6-dihydroxy-4-methylcyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol (PubChem CID 118883340) has the molecular formula C21H41N3O8 and a molecular weight of 463.57 g/mol. Its IUPAC name is (2R,5R)-2-[(1S,3R,4S)-2-amino-5-[(2R,6R)-3-amino-6-ethyloxan-2-yl]oxy-3,6-dihydroxy-4-methylcyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol.
| Compound Name | (2R,5R)-2-[(1S,3R,4S)-2-amino-5-[(2R,6R)-3-amino-6-ethyloxan-2-yl]oxy-3,6-dihydroxy-4-methylcyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol |
|---|---|
| PubChem CID | 118883340 |
| Molecular Formula | C21H41N3O8 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | (2R,5R)-2-[(1S,3R,4S)-2-amino-5-[(2R,6R)-3-amino-6-ethyloxan-2-yl]oxy-3,6-dihydroxy-4-methylcyclohexyl]oxy-5-methyl-4-(methylamino)oxane-3,5-diol |
| SMILES | CC[C@@H]1CCC(N)[C@@H](OC2C(O)[C@@H](O[C@H]3OC[C@](C)(O)C(NC)C3O)C(N)[C@H](O)[C@@H]2C)O1 |
| InChI | InChI=1S/C21H41N3O8/c1-5-10-6-7-11(22)19(30-10)31-16-9(2)13(25)12(23)17(14(16)26)32-20-15(27)18(24-4)21(3,28)8-29-20/h9-20,24-28H,5-8,22-23H2,1-4H3/t9-,10+,11?,12?,13+,14?,15?,16?,17-,18?,19+,20+,21-/m0/s1 |
| InChIKey | PGNGYDFIANCXRE-QXLFINNGSA-N |
| XLogP | -2.25 |
| TPSA | 181.91 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | -2.25 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |