C57H38N10 — CID 118886583
21,21-dimethyl-10,14-bis[4-(4-phenylphenyl)pteridin-2-yl]-10,14-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene (PubChem CID 118886583) has the molecular formula C57H38N10 and a molecular weight of 863.00 g/mol. Its IUPAC name is 21,21-dimethyl-10,14-bis[4-(4-phenylphenyl)pteridin-2-yl]-10,14-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene.
| Compound Name | 21,21-dimethyl-10,14-bis[4-(4-phenylphenyl)pteridin-2-yl]-10,14-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 118886583 |
| Molecular Formula | C57H38N10 |
| Molecular Weight | 863.00 g/mol |
| Exact Mass | 862.33 |
| IUPAC Name | 21,21-dimethyl-10,14-bis[4-(4-phenylphenyl)pteridin-2-yl]-10,14-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene |
| SMILES | CC1(C)c2ccccc2N(c2nc(-c3ccc(-c4ccccc4)cc3)c3nccnc3n2)c2cc3c(cc21)c1ccccc1n3-c1nc(-c2ccc(-c3ccccc3)cc2)c2nccnc2n1 |
| InChI | InChI=1S/C57H38N10/c1-57(2)43-18-10-12-20-46(43)67(56-63-50(52-54(65-56)61-32-30-59-52)40-27-23-38(24-28-40)36-15-7-4-8-16-36)48-34-47-42(33-44(48)57)41-17-9-11-19-45(41)66(47)55-62-49(51-53(64-55)60-31-29-58-51)39-25-21-37(22-26-39)35-13-5-3-6-14-35/h3-34H,1-2H3 |
| InChIKey | KWSYJWCMWQKQOX-UHFFFAOYSA-N |
| XLogP | 13.03 |
| TPSA | 111.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.00 |
| LogP ≤ 5 | 13.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |