C46H33N5 — CID 66804825
10-(4,6-Diphenyl-1,3,5-triazin-2-yl)-14,14-dimethyl-21-naphthalen-1-yl-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene (PubChem CID 66804825) has the molecular formula C46H33N5 and a molecular weight of 655.80 g/mol. Its IUPAC name is 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-14,14-dimethyl-21-naphthalen-1-yl-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene.
| Compound Name | 10-(4,6-Diphenyl-1,3,5-triazin-2-yl)-14,14-dimethyl-21-naphthalen-1-yl-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene |
|---|---|
| PubChem CID | 66804825 |
| Molecular Formula | C46H33N5 |
| Molecular Weight | 655.80 g/mol |
| Exact Mass | 655.27 |
| IUPAC Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-14,14-dimethyl-21-naphthalen-1-yl-10,21-diazapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(13),2,4,6,8,11,15,17,19-nonaene |
| SMILES | CC1(C2=CC=CC=C2N(C3=C1C=C4C(=C3)C5=CC=CC=C5N4C6=NC(=NC(=N6)C7=CC=CC=C7)C8=CC=CC=C8)C9=CC=CC1=CC=CC=C19)C |
| InChI | InChI=1S/C46H33N5/c1-46(2)36-24-12-14-26-40(36)50(38-27-15-21-30-16-9-10-22-33(30)38)42-28-35-34-23-11-13-25-39(34)51(41(35)29-37(42)46)45-48-43(31-17-5-3-6-18-31)47-44(49-45)32-19-7-4-8-20-32/h3-29H,1-2H3 |
| InChIKey | MANFPMOYWJQWQX-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 46.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | 1150 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.80 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |