C15H14O2S — CID 118886955
(4S,5R)-5-methyl-4-phenyl-5-thiophen-2-yloxolan-2-one (PubChem CID 118886955) has the molecular formula C15H14O2S and a molecular weight of 258.34 g/mol. Its IUPAC name is (4S,5R)-5-methyl-4-phenyl-5-thiophen-2-yloxolan-2-one.
| Compound Name | (4S,5R)-5-methyl-4-phenyl-5-thiophen-2-yloxolan-2-one |
|---|---|
| PubChem CID | 118886955 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | (4S,5R)-5-methyl-4-phenyl-5-thiophen-2-yloxolan-2-one |
| SMILES | C[C@@]1(c2cccs2)OC(=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H14O2S/c1-15(13-8-5-9-18-13)12(10-14(16)17-15)11-6-3-2-4-7-11/h2-9,12H,10H2,1H3/t12-,15+/m0/s1 |
| InChIKey | SQNNJSBLDDNRQS-SWLSCSKDSA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |