C11H22O7 — CID 118887899
(2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-(2-propoxyethoxy)oxane-3,4,5-triol (PubChem CID 118887899) has the molecular formula C11H22O7 and a molecular weight of 266.29 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-(2-propoxyethoxy)oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-(2-propoxyethoxy)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 118887899 |
| Molecular Formula | C11H22O7 |
| Molecular Weight | 266.29 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-(hydroxymethyl)-6-(2-propoxyethoxy)oxane-3,4,5-triol |
| SMILES | CCCOCCO[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C11H22O7/c1-2-3-16-4-5-17-11-10(15)9(14)8(13)7(6-12)18-11/h7-15H,2-6H2,1H3/t7-,8-,9+,10+,11+/m1/s1 |
| InChIKey | OCWPYBRKFKJHTF-UVOCVTCTSA-N |
| XLogP | -1.77 |
| TPSA | 108.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.29 |
| LogP ≤ 5 | -1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|