C18H27NO2 — CID 118889658
1-[4-(3,4-dihydro-2H-chromen-4-yloxy)butyl]piperidine (PubChem CID 118889658) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-2H-chromen-4-yloxy)butyl]piperidine.
| Compound Name | 1-[4-(3,4-dihydro-2H-chromen-4-yloxy)butyl]piperidine |
|---|---|
| PubChem CID | 118889658 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 1-[4-(3,4-dihydro-2H-chromen-4-yloxy)butyl]piperidine |
| SMILES | c1ccc2c(c1)OCCC2OCCCCN1CCCCC1 |
| InChI | InChI=1S/C18H27NO2/c1-4-11-19(12-5-1)13-6-7-14-20-18-10-15-21-17-9-3-2-8-16(17)18/h2-3,8-9,18H,1,4-7,10-15H2 |
| InChIKey | IFQLXTYLEWWBDE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|