C9H15N3O2 — CID 118890992
1-[2-[2-aminoethyl(methyl)amino]ethyl]pyrrole-2,5-dione (PubChem CID 118890992) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-[2-[2-aminoethyl(methyl)amino]ethyl]pyrrole-2,5-dione.
| Compound Name | 1-[2-[2-aminoethyl(methyl)amino]ethyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 118890992 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-[2-[2-aminoethyl(methyl)amino]ethyl]pyrrole-2,5-dione |
| SMILES | CN(CCN)CCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C9H15N3O2/c1-11(5-4-10)6-7-12-8(13)2-3-9(12)14/h2-3H,4-7,10H2,1H3 |
| InChIKey | IMRVRAAFUBPGSC-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|