C26H20N2O3 — CID 118894053
4-[6-(benzimidazol-1-ylmethyl)naphthalen-2-yl]-2-methoxybenzoic acid (PubChem CID 118894053) has the molecular formula C26H20N2O3 and a molecular weight of 408.46 g/mol. Its IUPAC name is 4-[6-(benzimidazol-1-ylmethyl)naphthalen-2-yl]-2-methoxybenzoic acid.
| Compound Name | 4-[6-(benzimidazol-1-ylmethyl)naphthalen-2-yl]-2-methoxybenzoic acid |
|---|---|
| PubChem CID | 118894053 |
| Molecular Formula | C26H20N2O3 |
| Molecular Weight | 408.46 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | 4-[6-(benzimidazol-1-ylmethyl)naphthalen-2-yl]-2-methoxybenzoic acid |
| SMILES | COc1cc(-c2ccc3cc(Cn4cnc5ccccc54)ccc3c2)ccc1C(=O)O |
| InChI | InChI=1S/C26H20N2O3/c1-31-25-14-21(10-11-22(25)26(29)30)20-9-8-18-12-17(6-7-19(18)13-20)15-28-16-27-23-4-2-3-5-24(23)28/h2-14,16H,15H2,1H3,(H,29,30) |
| InChIKey | NJAJSZGYKGLMDY-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.46 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |