C20H25NO4 — CID 118895015
1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propan-2-yl 3,5-dimethylbenzoate (PubChem CID 118895015) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is 1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propan-2-yl 3,5-dimethylbenzoate.
| Compound Name | 1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propan-2-yl 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 118895015 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 1-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propan-2-yl 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OC(C)CN2C(=O)C3CCCCC3C2=O)c1 |
| InChI | InChI=1S/C20H25NO4/c1-12-8-13(2)10-15(9-12)20(24)25-14(3)11-21-18(22)16-6-4-5-7-17(16)19(21)23/h8-10,14,16-17H,4-7,11H2,1-3H3 |
| InChIKey | HEMNQZMOIKPEMX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|