C17H22NO9P — CID 118896159
[5-benzoyloxy-2-[2-(dimethylamino)-2-oxoethoxy]carbonyl-5-oxopentyl]phosphonic acid (PubChem CID 118896159) has the molecular formula C17H22NO9P and a molecular weight of 415.34 g/mol. Its IUPAC name is [5-benzoyloxy-2-[2-(dimethylamino)-2-oxoethoxy]carbonyl-5-oxopentyl]phosphonic acid.
| Compound Name | [5-benzoyloxy-2-[2-(dimethylamino)-2-oxoethoxy]carbonyl-5-oxopentyl]phosphonic acid |
|---|---|
| PubChem CID | 118896159 |
| Molecular Formula | C17H22NO9P |
| Molecular Weight | 415.34 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | [5-benzoyloxy-2-[2-(dimethylamino)-2-oxoethoxy]carbonyl-5-oxopentyl]phosphonic acid |
| SMILES | CN(C)C(=O)COC(=O)C(CCC(=O)OC(=O)c1ccccc1)CP(=O)(O)O |
| InChI | InChI=1S/C17H22NO9P/c1-18(2)14(19)10-26-16(21)13(11-28(23,24)25)8-9-15(20)27-17(22)12-6-4-3-5-7-12/h3-7,13H,8-11H2,1-2H3,(H2,23,24,25) |
| InChIKey | QQSPCHYXASKCKV-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.34 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|