C19H25O11P — CID 118895922
[5-benzoyloxy-5-oxo-2-(1-propan-2-yloxycarbonyloxyethoxycarbonyl)pentyl]phosphonic acid (PubChem CID 118895922) has the molecular formula C19H25O11P and a molecular weight of 460.37 g/mol. Its IUPAC name is [5-benzoyloxy-5-oxo-2-(1-propan-2-yloxycarbonyloxyethoxycarbonyl)pentyl]phosphonic acid.
| Compound Name | [5-benzoyloxy-5-oxo-2-(1-propan-2-yloxycarbonyloxyethoxycarbonyl)pentyl]phosphonic acid |
|---|---|
| PubChem CID | 118895922 |
| Molecular Formula | C19H25O11P |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | [5-benzoyloxy-5-oxo-2-(1-propan-2-yloxycarbonyloxyethoxycarbonyl)pentyl]phosphonic acid |
| SMILES | CC(C)OC(=O)OC(C)OC(=O)C(CCC(=O)OC(=O)c1ccccc1)CP(=O)(O)O |
| InChI | InChI=1S/C19H25O11P/c1-12(2)27-19(23)29-13(3)28-18(22)15(11-31(24,25)26)9-10-16(20)30-17(21)14-7-5-4-6-8-14/h4-8,12-13,15H,9-11H2,1-3H3,(H2,24,25,26) |
| InChIKey | SGZXKGKURYGUKB-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|