C13H15NO5 — CID 174341310
(2S)-2-amino-5-(4-methylbenzoyl)oxy-5-oxopentanoic acid (PubChem CID 174341310) has the molecular formula C13H15NO5 and a molecular weight of 265.26 g/mol. Its IUPAC name is (2S)-2-amino-5-(4-methylbenzoyl)oxy-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-(4-methylbenzoyl)oxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174341310 |
| Molecular Formula | C13H15NO5 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | (2S)-2-amino-5-(4-methylbenzoyl)oxy-5-oxopentanoic acid |
| SMILES | Cc1ccc(C(=O)OC(=O)CC[C@H](N)C(=O)O)cc1 |
| InChI | InChI=1S/C13H15NO5/c1-8-2-4-9(5-3-8)13(18)19-11(15)7-6-10(14)12(16)17/h2-5,10H,6-7,14H2,1H3,(H,16,17)/t10-/m0/s1 |
| InChIKey | BTPPQGFPICOHDV-JTQLQIEISA-N |
| XLogP | 0.87 |
| TPSA | 106.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|