C23H27NO5 — CID 54187133
(2S)-2-amino-5-[4-[4-(4-hydroxyphenyl)hex-3-en-3-yl]phenoxy]-5-oxopentanoic acid (PubChem CID 54187133) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is (2S)-2-amino-5-[4-[4-(4-hydroxyphenyl)hex-3-en-3-yl]phenoxy]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[4-[4-(4-hydroxyphenyl)hex-3-en-3-yl]phenoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 54187133 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | (2S)-2-amino-5-[4-[4-(4-hydroxyphenyl)hex-3-en-3-yl]phenoxy]-5-oxopentanoic acid |
| SMILES | CCC(=C(CC)c1ccc(OC(=O)CC[C@H](N)C(=O)O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H27NO5/c1-3-19(15-5-9-17(25)10-6-15)20(4-2)16-7-11-18(12-8-16)29-22(26)14-13-21(24)23(27)28/h5-12,21,25H,3-4,13-14,24H2,1-2H3,(H,27,28)/t21-/m0/s1 |
| InChIKey | PFVWQLPIPFMVOJ-NRFANRHFSA-N |
| XLogP | 4.22 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|