C33H45N4O8S+ — CID 118896459
4-[3-[6-[(3,4-dimethoxyphenyl)sulfonylamino]-1,3-dimethyl-2-oxobenzimidazol-5-yl]oxy-5-propoxyphenoxy]butyl-trimethylazanium (PubChem CID 118896459) has the molecular formula C33H45N4O8S+ and a molecular weight of 657.81 g/mol. Its IUPAC name is 4-[3-[6-[(3,4-dimethoxyphenyl)sulfonylamino]-1,3-dimethyl-2-oxobenzimidazol-5-yl]oxy-5-propoxyphenoxy]butyl-trimethylazanium.
| Compound Name | 4-[3-[6-[(3,4-dimethoxyphenyl)sulfonylamino]-1,3-dimethyl-2-oxobenzimidazol-5-yl]oxy-5-propoxyphenoxy]butyl-trimethylazanium |
|---|---|
| PubChem CID | 118896459 |
| Molecular Formula | C33H45N4O8S+ |
| Molecular Weight | 657.81 g/mol |
| Exact Mass | 657.30 |
| IUPAC Name | 4-[3-[6-[(3,4-dimethoxyphenyl)sulfonylamino]-1,3-dimethyl-2-oxobenzimidazol-5-yl]oxy-5-propoxyphenoxy]butyl-trimethylazanium |
| SMILES | CCCOc1cc(OCCCC[N+](C)(C)C)cc(Oc2cc3c(cc2NS(=O)(=O)c2ccc(OC)c(OC)c2)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C33H45N4O8S/c1-9-15-43-23-17-24(44-16-11-10-14-37(4,5)6)19-25(18-23)45-31-22-29-28(35(2)33(38)36(29)3)21-27(31)34-46(39,40)26-12-13-30(41-7)32(20-26)42-8/h12-13,17-22,34H,9-11,14-16H2,1-8H3/q+1 |
| InChIKey | YVJMVWPQCRPUAY-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.81 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|