C31H40N4O8S — CID 118896837
N-[1,3-dimethyl-6-[3-[4-(methylamino)butoxy]-5-propoxyphenoxy]-2-oxobenzimidazol-5-yl]-3,4-dimethoxybenzenesulfonamide (PubChem CID 118896837) has the molecular formula C31H40N4O8S and a molecular weight of 628.75 g/mol. Its IUPAC name is N-[1,3-dimethyl-6-[3-[4-(methylamino)butoxy]-5-propoxyphenoxy]-2-oxobenzimidazol-5-yl]-3,4-dimethoxybenzenesulfonamide.
| Compound Name | N-[1,3-dimethyl-6-[3-[4-(methylamino)butoxy]-5-propoxyphenoxy]-2-oxobenzimidazol-5-yl]-3,4-dimethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 118896837 |
| Molecular Formula | C31H40N4O8S |
| Molecular Weight | 628.75 g/mol |
| Exact Mass | 628.26 |
| IUPAC Name | N-[1,3-dimethyl-6-[3-[4-(methylamino)butoxy]-5-propoxyphenoxy]-2-oxobenzimidazol-5-yl]-3,4-dimethoxybenzenesulfonamide |
| SMILES | CCCOc1cc(OCCCCNC)cc(Oc2cc3c(cc2NS(=O)(=O)c2ccc(OC)c(OC)c2)n(C)c(=O)n3C)c1 |
| InChI | InChI=1S/C31H40N4O8S/c1-7-13-41-21-15-22(42-14-9-8-12-32-2)17-23(16-21)43-29-20-27-26(34(3)31(36)35(27)4)19-25(29)33-44(37,38)24-10-11-28(39-5)30(18-24)40-6/h10-11,15-20,32-33H,7-9,12-14H2,1-6H3 |
| InChIKey | JSICEMKVYDDPHV-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.75 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|