C17H20ClF2NO2 — CID 118897632
3-chloro-5-cyclopropyl-4-(4,4-difluoropiperidin-1-yl)-2-ethoxybenzaldehyde (PubChem CID 118897632) has the molecular formula C17H20ClF2NO2 and a molecular weight of 343.80 g/mol. Its IUPAC name is 3-chloro-5-cyclopropyl-4-(4,4-difluoropiperidin-1-yl)-2-ethoxybenzaldehyde.
| Compound Name | 3-chloro-5-cyclopropyl-4-(4,4-difluoropiperidin-1-yl)-2-ethoxybenzaldehyde |
|---|---|
| PubChem CID | 118897632 |
| Molecular Formula | C17H20ClF2NO2 |
| Molecular Weight | 343.80 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 3-chloro-5-cyclopropyl-4-(4,4-difluoropiperidin-1-yl)-2-ethoxybenzaldehyde |
| SMILES | CCOc1c(C=O)cc(C2CC2)c(N2CCC(F)(F)CC2)c1Cl |
| InChI | InChI=1S/C17H20ClF2NO2/c1-2-23-16-12(10-22)9-13(11-3-4-11)15(14(16)18)21-7-5-17(19,20)6-8-21/h9-11H,2-8H2,1H3 |
| InChIKey | NXPXLWGJBJDCIT-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.80 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|