C19H25F2NO3 — CID 118897932
ethyl 2-cyclopropyl-4-(4,4-difluoropiperidin-1-yl)-5-ethoxybenzoate (PubChem CID 118897932) has the molecular formula C19H25F2NO3 and a molecular weight of 353.41 g/mol. Its IUPAC name is ethyl 2-cyclopropyl-4-(4,4-difluoropiperidin-1-yl)-5-ethoxybenzoate.
| Compound Name | ethyl 2-cyclopropyl-4-(4,4-difluoropiperidin-1-yl)-5-ethoxybenzoate |
|---|---|
| PubChem CID | 118897932 |
| Molecular Formula | C19H25F2NO3 |
| Molecular Weight | 353.41 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | ethyl 2-cyclopropyl-4-(4,4-difluoropiperidin-1-yl)-5-ethoxybenzoate |
| SMILES | CCOC(=O)c1cc(OCC)c(N2CCC(F)(F)CC2)cc1C1CC1 |
| InChI | InChI=1S/C19H25F2NO3/c1-3-24-17-12-15(18(23)25-4-2)14(13-5-6-13)11-16(17)22-9-7-19(20,21)8-10-22/h11-13H,3-10H2,1-2H3 |
| InChIKey | WBNAWERIOOURGA-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |