C16H19N3O3 — CID 11889776
methyl (1S,3S,8R)-5'-amino-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-1-carboxylate (PubChem CID 11889776) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is methyl (1S,3S,8R)-5'-amino-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-1-carboxylate.
| Compound Name | methyl (1S,3S,8R)-5'-amino-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-1-carboxylate |
|---|---|
| PubChem CID | 11889776 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | methyl (1S,3S,8R)-5'-amino-2'-oxospiro[1,2,5,6,7,8-hexahydropyrrolizine-3,3'-1H-indole]-1-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@]2(C(=O)Nc3ccc(N)cc32)N2CCC[C@H]12 |
| InChI | InChI=1S/C16H19N3O3/c1-22-14(20)10-8-16(19-6-2-3-13(10)19)11-7-9(17)4-5-12(11)18-15(16)21/h4-5,7,10,13H,2-3,6,8,17H2,1H3,(H,18,21)/t10-,13+,16-/m0/s1 |
| InChIKey | UTIANWNXFPNUBS-WNMQOVRZSA-N |
| XLogP | 1.07 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|