C14H16O6 — CID 11889835
(1R,2S,6R,7S)-9-methoxycarbonyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylic acid (PubChem CID 11889835) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is (1R,2S,6R,7S)-9-methoxycarbonyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylic acid.
| Compound Name | (1R,2S,6R,7S)-9-methoxycarbonyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylic acid |
|---|---|
| PubChem CID | 11889835 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (1R,2S,6R,7S)-9-methoxycarbonyl-4,4-dimethyl-3,5-dioxatricyclo[5.2.2.02,6]undeca-8,10-diene-8-carboxylic acid |
| SMILES | COC(=O)C1=C(C(=O)O)[C@@H]2C=C[C@H]1[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C14H16O6/c1-14(2)19-10-6-4-5-7(11(10)20-14)9(13(17)18-3)8(6)12(15)16/h4-7,10-11H,1-3H3,(H,15,16)/t6-,7+,10+,11-/m0/s1 |
| InChIKey | NXBKFHYZGJLWMK-HJGGDWJDSA-N |
| XLogP | 0.88 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|