C28H30N4O5 — CID 118900194
tert-butyl 4-[2-[4-(5-cyano-7-formyl-1,3-benzoxazol-2-yl)anilino]prop-2-enoxy]piperidine-1-carboxylate (PubChem CID 118900194) has the molecular formula C28H30N4O5 and a molecular weight of 502.57 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-(5-cyano-7-formyl-1,3-benzoxazol-2-yl)anilino]prop-2-enoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-(5-cyano-7-formyl-1,3-benzoxazol-2-yl)anilino]prop-2-enoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118900194 |
| Molecular Formula | C28H30N4O5 |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.22 |
| IUPAC Name | tert-butyl 4-[2-[4-(5-cyano-7-formyl-1,3-benzoxazol-2-yl)anilino]prop-2-enoxy]piperidine-1-carboxylate |
| SMILES | C=C(COC1CCN(C(=O)OC(C)(C)C)CC1)Nc1ccc(-c2nc3cc(C#N)cc(C=O)c3o2)cc1 |
| InChI | InChI=1S/C28H30N4O5/c1-18(17-35-23-9-11-32(12-10-23)27(34)37-28(2,3)4)30-22-7-5-20(6-8-22)26-31-24-14-19(15-29)13-21(16-33)25(24)36-26/h5-8,13-14,16,23,30H,1,9-12,17H2,2-4H3 |
| InChIKey | BDTKIYIHUHUBLA-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|