C14H22N2O4 — CID 90155873
tert-butyl 4-(3-cyano-2-oxopropoxy)piperidine-1-carboxylate (PubChem CID 90155873) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is tert-butyl 4-(3-cyano-2-oxopropoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(3-cyano-2-oxopropoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90155873 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | tert-butyl 4-(3-cyano-2-oxopropoxy)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(OCC(=O)CC#N)CC1 |
| InChI | InChI=1S/C14H22N2O4/c1-14(2,3)20-13(18)16-8-5-12(6-9-16)19-10-11(17)4-7-15/h12H,4-6,8-10H2,1-3H3 |
| InChIKey | SAHWSFWQFBDEPD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |