C13H21N3O2 — CID 91097906
tert-butyl 4-(2-cyanoethanimidoyl)piperidine-1-carboxylate (PubChem CID 91097906) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is tert-butyl 4-(2-cyanoethanimidoyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-cyanoethanimidoyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 91097906 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | tert-butyl 4-(2-cyanoethanimidoyl)piperidine-1-carboxylate |
| SMILES | [H]/N=C(\CC#N)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H21N3O2/c1-13(2,3)18-12(17)16-8-5-10(6-9-16)11(15)4-7-14/h10,15H,4-6,8-9H2,1-3H3/b15-11+ |
| InChIKey | SZRUAKPSXMYYFL-RVDMUPIBSA-N |
| XLogP | 2.57 |
| TPSA | 77.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|