C28H30N4O — CID 118900854
N-[4-[6-[1-(2-methoxyethylamino)ethenyl]-3-pyridinyl]phenyl]-2,6,8-trimethylquinolin-4-amine (PubChem CID 118900854) has the molecular formula C28H30N4O and a molecular weight of 438.58 g/mol. Its IUPAC name is N-[4-[6-[1-(2-methoxyethylamino)ethenyl]-3-pyridinyl]phenyl]-2,6,8-trimethylquinolin-4-amine.
| Compound Name | N-[4-[6-[1-(2-methoxyethylamino)ethenyl]-3-pyridinyl]phenyl]-2,6,8-trimethylquinolin-4-amine |
|---|---|
| PubChem CID | 118900854 |
| Molecular Formula | C28H30N4O |
| Molecular Weight | 438.58 g/mol |
| Exact Mass | 438.24 |
| IUPAC Name | N-[4-[6-[1-(2-methoxyethylamino)ethenyl]-3-pyridinyl]phenyl]-2,6,8-trimethylquinolin-4-amine |
| SMILES | C=C(NCCOC)c1ccc(-c2ccc(Nc3cc(C)nc4c(C)cc(C)cc34)cc2)cn1 |
| InChI | InChI=1S/C28H30N4O/c1-18-14-19(2)28-25(15-18)27(16-20(3)31-28)32-24-9-6-22(7-10-24)23-8-11-26(30-17-23)21(4)29-12-13-33-5/h6-11,14-17,29H,4,12-13H2,1-3,5H3,(H,31,32) |
| InChIKey | AQHGGNVSRZRGQT-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.58 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|