C8H11NO5S — CID 118901333
3-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid (PubChem CID 118901333) has the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. Its IUPAC name is 3-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid.
| Compound Name | 3-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid |
|---|---|
| PubChem CID | 118901333 |
| Molecular Formula | C8H11NO5S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)-2-methylpropane-1-sulfonic acid |
| SMILES | CC(CN1C(=O)C=CC1=O)CS(=O)(=O)O |
| InChI | InChI=1S/C8H11NO5S/c1-6(5-15(12,13)14)4-9-7(10)2-3-8(9)11/h2-3,6H,4-5H2,1H3,(H,12,13,14) |
| InChIKey | WMMWSCMHLGRNPR-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|