C13H25NO — CID 118901669
2-tert-butyl-6-ethyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole (PubChem CID 118901669) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-tert-butyl-6-ethyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole.
| Compound Name | 2-tert-butyl-6-ethyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
|---|---|
| PubChem CID | 118901669 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 2-tert-butyl-6-ethyl-3,3a,4,6,7,7a-hexahydro-1H-pyrano[3,4-c]pyrrole |
| SMILES | CCC1CC2CN(C(C)(C)C)CC2CO1 |
| InChI | InChI=1S/C13H25NO/c1-5-12-6-10-7-14(13(2,3)4)8-11(10)9-15-12/h10-12H,5-9H2,1-4H3 |
| InChIKey | YENYQHOZXCFFOR-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |