C22H24N2O6 — CID 118902767
(2S)-2-acetamido-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoic acid (PubChem CID 118902767) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is (2S)-2-acetamido-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoic acid.
| Compound Name | (2S)-2-acetamido-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 118902767 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | (2S)-2-acetamido-3-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethoxy]propanoic acid |
| SMILES | CC(=O)N[C@@H](COCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H24N2O6/c1-14(25)24-20(21(26)27)13-29-11-10-23-22(28)30-12-19-17-8-4-2-6-15(17)16-7-3-5-9-18(16)19/h2-9,19-20H,10-13H2,1H3,(H,23,28)(H,24,25)(H,26,27)/t20-/m0/s1 |
| InChIKey | OKEXLXVRVFFJOW-FQEVSTJZSA-N |
| XLogP | 2.13 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|