C26H19FN2O2S — CID 118903748
3-[5-(4-fluorophenyl)-2-(4-hydroxybut-1-ynyl)-4-pyridin-4-ylthiophen-3-yl]benzamide (PubChem CID 118903748) has the molecular formula C26H19FN2O2S and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[5-(4-fluorophenyl)-2-(4-hydroxybut-1-ynyl)-4-pyridin-4-ylthiophen-3-yl]benzamide.
| Compound Name | 3-[5-(4-fluorophenyl)-2-(4-hydroxybut-1-ynyl)-4-pyridin-4-ylthiophen-3-yl]benzamide |
|---|---|
| PubChem CID | 118903748 |
| Molecular Formula | C26H19FN2O2S |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 3-[5-(4-fluorophenyl)-2-(4-hydroxybut-1-ynyl)-4-pyridin-4-ylthiophen-3-yl]benzamide |
| SMILES | NC(=O)c1cccc(-c2c(C#CCCO)sc(-c3ccc(F)cc3)c2-c2ccncc2)c1 |
| InChI | InChI=1S/C26H19FN2O2S/c27-21-9-7-18(8-10-21)25-24(17-11-13-29-14-12-17)23(22(32-25)6-1-2-15-30)19-4-3-5-20(16-19)26(28)31/h3-5,7-14,16,30H,2,15H2,(H2,28,31) |
| InChIKey | QXCSXVDYCHMEOY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|