C19H20FNO3S — CID 118904602
8-fluoro-1-[(4-methoxyphenyl)methyl]-5-(methylsulfanylmethoxy)-3,4-dihydroquinolin-2-one (PubChem CID 118904602) has the molecular formula C19H20FNO3S and a molecular weight of 361.44 g/mol. Its IUPAC name is 8-fluoro-1-[(4-methoxyphenyl)methyl]-5-(methylsulfanylmethoxy)-3,4-dihydroquinolin-2-one.
| Compound Name | 8-fluoro-1-[(4-methoxyphenyl)methyl]-5-(methylsulfanylmethoxy)-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 118904602 |
| Molecular Formula | C19H20FNO3S |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 8-fluoro-1-[(4-methoxyphenyl)methyl]-5-(methylsulfanylmethoxy)-3,4-dihydroquinolin-2-one |
| SMILES | COc1ccc(CN2C(=O)CCc3c(OCSC)ccc(F)c32)cc1 |
| InChI | InChI=1S/C19H20FNO3S/c1-23-14-5-3-13(4-6-14)11-21-18(22)10-7-15-17(24-12-25-2)9-8-16(20)19(15)21/h3-6,8-9H,7,10-12H2,1-2H3 |
| InChIKey | YUHSQZSSWBCMAC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|