C25H26FN3O6 — CID 118904927
4-[[8-fluoro-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4-dihydroquinolin-5-yl]oxymethyl]-4-isocyanatopiperidine-1-carboxylic acid (PubChem CID 118904927) has the molecular formula C25H26FN3O6 and a molecular weight of 483.50 g/mol. Its IUPAC name is 4-[[8-fluoro-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4-dihydroquinolin-5-yl]oxymethyl]-4-isocyanatopiperidine-1-carboxylic acid.
| Compound Name | 4-[[8-fluoro-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4-dihydroquinolin-5-yl]oxymethyl]-4-isocyanatopiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 118904927 |
| Molecular Formula | C25H26FN3O6 |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 4-[[8-fluoro-1-[(4-methoxyphenyl)methyl]-2-oxo-3,4-dihydroquinolin-5-yl]oxymethyl]-4-isocyanatopiperidine-1-carboxylic acid |
| SMILES | COc1ccc(CN2C(=O)CCc3c(OCC4(N=C=O)CCN(C(=O)O)CC4)ccc(F)c32)cc1 |
| InChI | InChI=1S/C25H26FN3O6/c1-34-18-4-2-17(3-5-18)14-29-22(31)9-6-19-21(8-7-20(26)23(19)29)35-15-25(27-16-30)10-12-28(13-11-25)24(32)33/h2-5,7-8H,6,9-15H2,1H3,(H,32,33) |
| InChIKey | BHJBPSSLVZNJJG-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|