C23H21F7N2O4 — CID 118904656
5-[[1-[2,6-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-4-hydroxypiperidin-4-yl]methoxy]-7,8-difluoro-3,4-dihydro-1H-quinolin-2-one (PubChem CID 118904656) has the molecular formula C23H21F7N2O4 and a molecular weight of 522.42 g/mol. Its IUPAC name is 5-[[1-[2,6-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-4-hydroxypiperidin-4-yl]methoxy]-7,8-difluoro-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 5-[[1-[2,6-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-4-hydroxypiperidin-4-yl]methoxy]-7,8-difluoro-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 118904656 |
| Molecular Formula | C23H21F7N2O4 |
| Molecular Weight | 522.42 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 5-[[1-[2,6-difluoro-4-(2,2,2-trifluoroethoxy)phenyl]-4-hydroxypiperidin-4-yl]methoxy]-7,8-difluoro-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2c(OCC3(O)CCN(c4c(F)cc(OCC(F)(F)F)cc4F)CC3)cc(F)c(F)c2N1 |
| InChI | InChI=1S/C23H21F7N2O4/c24-14-9-17(13-1-2-18(33)31-20(13)19(14)27)36-10-22(34)3-5-32(6-4-22)21-15(25)7-12(8-16(21)26)35-11-23(28,29)30/h7-9,34H,1-6,10-11H2,(H,31,33) |
| InChIKey | JQOFCIUEDNRZNI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.42 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|