C21H20ClF2IN2O3 — CID 130382399
7-chloro-4-[[1-[2,6-difluoro-4-(iodomethyl)phenyl]-4-hydroxypiperidin-4-yl]methoxy]-1,3-dihydroindol-2-one (PubChem CID 130382399) has the molecular formula C21H20ClF2IN2O3 and a molecular weight of 548.76 g/mol. Its IUPAC name is 7-chloro-4-[[1-[2,6-difluoro-4-(iodomethyl)phenyl]-4-hydroxypiperidin-4-yl]methoxy]-1,3-dihydroindol-2-one.
| Compound Name | 7-chloro-4-[[1-[2,6-difluoro-4-(iodomethyl)phenyl]-4-hydroxypiperidin-4-yl]methoxy]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 130382399 |
| Molecular Formula | C21H20ClF2IN2O3 |
| Molecular Weight | 548.76 g/mol |
| Exact Mass | 548.02 |
| IUPAC Name | 7-chloro-4-[[1-[2,6-difluoro-4-(iodomethyl)phenyl]-4-hydroxypiperidin-4-yl]methoxy]-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2c(OCC3(O)CCN(c4c(F)cc(CI)cc4F)CC3)ccc(Cl)c2N1 |
| InChI | InChI=1S/C21H20ClF2IN2O3/c22-14-1-2-17(13-9-18(28)26-19(13)14)30-11-21(29)3-5-27(6-4-21)20-15(23)7-12(10-25)8-16(20)24/h1-2,7-8,29H,3-6,9-11H2,(H,26,28) |
| InChIKey | DQKMYQXPNGSJOW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.76 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|