C22H17F3N4O2 — CID 118905413
3-[[4-(3-methoxyanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]naphthalen-2-ol (PubChem CID 118905413) has the molecular formula C22H17F3N4O2 and a molecular weight of 426.40 g/mol. Its IUPAC name is 3-[[4-(3-methoxyanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]naphthalen-2-ol.
| Compound Name | 3-[[4-(3-methoxyanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]naphthalen-2-ol |
|---|---|
| PubChem CID | 118905413 |
| Molecular Formula | C22H17F3N4O2 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-[[4-(3-methoxyanilino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]naphthalen-2-ol |
| SMILES | COc1cccc(Nc2nc(Nc3cc4ccccc4cc3O)ncc2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H17F3N4O2/c1-31-16-8-4-7-15(11-16)27-20-17(22(23,24)25)12-26-21(29-20)28-18-9-13-5-2-3-6-14(13)10-19(18)30/h2-12,30H,1H3,(H2,26,27,28,29) |
| InChIKey | KDHWJRDTCUNLLZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|