C24H28Cl2N6O — CID 118906795
(2R)-2-(3,5-dichloroanilino)-1-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]pentan-1-one (PubChem CID 118906795) has the molecular formula C24H28Cl2N6O and a molecular weight of 487.44 g/mol. Its IUPAC name is (2R)-2-(3,5-dichloroanilino)-1-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]pentan-1-one.
| Compound Name | (2R)-2-(3,5-dichloroanilino)-1-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]pentan-1-one |
|---|---|
| PubChem CID | 118906795 |
| Molecular Formula | C24H28Cl2N6O |
| Molecular Weight | 487.44 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | (2R)-2-(3,5-dichloroanilino)-1-[1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]pentan-1-one |
| SMILES | CCC[C@@H](Nc1cc(Cl)cc(Cl)c1)C(=O)N1CCC2CCN(c3ncnc4[nH]ccc34)C2C1 |
| InChI | InChI=1S/C24H28Cl2N6O/c1-2-3-20(30-18-11-16(25)10-17(26)12-18)24(33)31-8-5-15-6-9-32(21(15)13-31)23-19-4-7-27-22(19)28-14-29-23/h4,7,10-12,14-15,20-21,30H,2-3,5-6,8-9,13H2,1H3,(H,27,28,29)/t15?,20-,21?/m1/s1 |
| InChIKey | CRNONVFWMLKVEK-VZDHWGDASA-N |
| XLogP | 4.97 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.44 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |