About 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine
2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 118908038) has the molecular formula C13H17F3N4
and a molecular weight of 286.30 g/mol. Its IUPAC name is 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| PubChem CID | 118908038 |
| Molecular Formula | C13H17F3N4 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | FC(F)(F)c1cnc(NC2CCC2)nc1NC1CCC1 |
| InChI | InChI=1S/C13H17F3N4/c14-13(15,16)10-7-17-12(19-9-5-2-6-9)20-11(10)18-8-3-1-4-8/h7-9H,1-6H2,(H2,17,18,19,20) |
| InChIKey | RANKMCGOEJGEJE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine?
The IUPAC name of 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine (CID 118908038) is 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine is FC(F)(F)c1cnc(NC2CCC2)nc1NC1CCC1.
What is the InChIKey of 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine?
The InChIKey is RANKMCGOEJGEJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17F3N4/c14-13(15,16)10-7-17-12(19-9-5-2-6-9)20-11(10)18-8-3-1-4-8/h7-9H,1-6H2,(H2,17,18,19,20).
What are the key properties of 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine?
2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine has a molecular weight of 286.30 g/mol, XLogP of 3.42, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,4-N-di(cyclobutyl)-5-(trifluoromethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 118908038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).