C22H20ClF2N2O4P — CID 118908521
CID 118908521 (PubChem CID 118908521) has the molecular formula C22H20ClF2N2O4P and a molecular weight of 480.84 g/mol.
| Compound Name | CID 118908521 |
|---|---|
| PubChem CID | 118908521 |
| Molecular Formula | C22H20ClF2N2O4P |
| Molecular Weight | 480.84 g/mol |
| Exact Mass | 480.08 |
| IUPAC Name | — |
| SMILES | C=P1=C2[C@H](Oc3[nH]c4cc(Cl)c(OCc5c(F)cccc5F)nc4c3C)CO[C@@H]2[C@H](O)C1 |
| InChI | InChI=1S/C22H20ClF2N2O4P/c1-10-18-15(26-21(10)31-17-8-29-19-16(28)9-32(2)20(17)19)6-12(23)22(27-18)30-7-11-13(24)4-3-5-14(11)25/h3-6,16-17,19,26,28H,2,7-9H2,1H3/t16-,17-,19-/m1/s1 |
| InChIKey | DJHJVQXJRAQBSI-ZHALLVOQSA-N |
| XLogP | 3.99 |
| TPSA | 76.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.84 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|