C24H21ClF2N2O5 — CID 118908633
(3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(3,6-dihydro-2H-pyran-4-yl)-2,6-difluorophenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol (PubChem CID 118908633) has the molecular formula C24H21ClF2N2O5 and a molecular weight of 490.89 g/mol. Its IUPAC name is (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(3,6-dihydro-2H-pyran-4-yl)-2,6-difluorophenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol.
| Compound Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(3,6-dihydro-2H-pyran-4-yl)-2,6-difluorophenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
|---|---|
| PubChem CID | 118908633 |
| Molecular Formula | C24H21ClF2N2O5 |
| Molecular Weight | 490.89 g/mol |
| Exact Mass | 490.11 |
| IUPAC Name | (3R,3aR,6R,6aR)-6-[[6-chloro-5-[4-(3,6-dihydro-2H-pyran-4-yl)-2,6-difluorophenyl]-1H-pyrrolo[3,2-b]pyridin-2-yl]oxy]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-ol |
| SMILES | O[C@@H]1CO[C@H]2[C@@H]1OC[C@H]2Oc1cc2nc(-c3c(F)cc(C4=CCOCC4)cc3F)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C24H21ClF2N2O5/c25-13-7-16-17(8-20(28-16)34-19-10-33-23-18(30)9-32-24(19)23)29-22(13)21-14(26)5-12(6-15(21)27)11-1-3-31-4-2-11/h1,5-8,18-19,23-24,28,30H,2-4,9-10H2/t18-,19-,23-,24-/m1/s1 |
| InChIKey | VVCNOKNKKISKNK-DJEYIWCMSA-N |
| XLogP | 3.87 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.89 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |