C17H20N4O2 — CID 118911376
2-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]pyrimidine (PubChem CID 118911376) has the molecular formula C17H20N4O2 and a molecular weight of 312.37 g/mol. Its IUPAC name is 2-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 118911376 |
| Molecular Formula | C17H20N4O2 |
| Molecular Weight | 312.37 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 2-[4-[(1S)-1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]pyrimidine |
| SMILES | C[C@@H](c1ccc2c(c1)OCO2)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C17H20N4O2/c1-13(14-3-4-15-16(11-14)23-12-22-15)20-7-9-21(10-8-20)17-18-5-2-6-19-17/h2-6,11,13H,7-10,12H2,1H3/t13-/m0/s1 |
| InChIKey | BQUNAXZOBQQSTM-ZDUSSCGKSA-N |
| XLogP | 2.09 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |