C18H21N5O3 — CID 166654969
N-[2-[4-[1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]formamide (PubChem CID 166654969) has the molecular formula C18H21N5O3 and a molecular weight of 355.40 g/mol. Its IUPAC name is N-[2-[4-[1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]formamide.
| Compound Name | N-[2-[4-[1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]formamide |
|---|---|
| PubChem CID | 166654969 |
| Molecular Formula | C18H21N5O3 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | N-[2-[4-[1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]pyrimidin-5-yl]formamide |
| SMILES | CC(c1ccc2c(c1)OCO2)N1CCN(c2ncc(NC=O)cn2)CC1 |
| InChI | InChI=1S/C18H21N5O3/c1-13(14-2-3-16-17(8-14)26-12-25-16)22-4-6-23(7-5-22)18-19-9-15(10-20-18)21-11-24/h2-3,8-11,13H,4-7,12H2,1H3,(H,21,24) |
| InChIKey | ZBBJBPSWJLTRGF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|