C18H26N4O2 — CID 145023395
(1E,3Z)-1-[4-[1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]penta-1,3-diene-1,4-diamine (PubChem CID 145023395) has the molecular formula C18H26N4O2 and a molecular weight of 330.43 g/mol. Its IUPAC name is (1E,3Z)-1-[4-[1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]penta-1,3-diene-1,4-diamine.
| Compound Name | (1E,3Z)-1-[4-[1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]penta-1,3-diene-1,4-diamine |
|---|---|
| PubChem CID | 145023395 |
| Molecular Formula | C18H26N4O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.21 |
| IUPAC Name | (1E,3Z)-1-[4-[1-(1,3-benzodioxol-5-yl)ethyl]piperazin-1-yl]penta-1,3-diene-1,4-diamine |
| SMILES | C/C(N)=C/C=C(\N)N1CCN(C(C)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C18H26N4O2/c1-13(19)3-6-18(20)22-9-7-21(8-10-22)14(2)15-4-5-16-17(11-15)24-12-23-16/h3-6,11,14H,7-10,12,19-20H2,1-2H3/b13-3-,18-6+ |
| InChIKey | FXPFRMAYBXJNBK-TZLYQJGSSA-N |
| XLogP | 1.76 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|