C17H22N4O2 — CID 145023476
4-[1-(1,3-benzodioxol-5-yl)ethyl]-N'-ethenyl-N-methylidenepiperazine-1-carboximidamide (PubChem CID 145023476) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 4-[1-(1,3-benzodioxol-5-yl)ethyl]-N'-ethenyl-N-methylidenepiperazine-1-carboximidamide.
| Compound Name | 4-[1-(1,3-benzodioxol-5-yl)ethyl]-N'-ethenyl-N-methylidenepiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 145023476 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 4-[1-(1,3-benzodioxol-5-yl)ethyl]-N'-ethenyl-N-methylidenepiperazine-1-carboximidamide |
| SMILES | C=C/N=C(\N=C)N1CCN(C(C)c2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C17H22N4O2/c1-4-19-17(18-3)21-9-7-20(8-10-21)13(2)14-5-6-15-16(11-14)23-12-22-15/h4-6,11,13H,1,3,7-10,12H2,2H3/b19-17+ |
| InChIKey | HKWJCPBJZGLDSA-HTXNQAPBSA-N |
| XLogP | 2.29 |
| TPSA | 49.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|