C19H27N3O2 — CID 154685814
7-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;ethane (PubChem CID 154685814) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 7-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;ethane.
| Compound Name | 7-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;ethane |
|---|---|
| PubChem CID | 154685814 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 7-[1-(1,3-benzodioxol-5-yl)ethyl]-2-methyl-5,6,8,9-tetrahydroimidazo[1,2-d][1,4]diazepine;ethane |
| SMILES | CC.Cc1cn2c(n1)CCN(C(C)c1ccc3c(c1)OCO3)CC2 |
| InChI | InChI=1S/C17H21N3O2.C2H6/c1-12-10-20-8-7-19(6-5-17(20)18-12)13(2)14-3-4-15-16(9-14)22-11-21-15;1-2/h3-4,9-10,13H,5-8,11H2,1-2H3;1-2H3 |
| InChIKey | DUWICAFSOBOYNM-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 39.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |