C18H24N2O3 — CID 154685671
6-[1-(1,3-benzodioxol-5-yl)ethyl]-4,5,7,8-tetrahydro-[1,2]oxazolo[4,5-d]azepine;ethane (PubChem CID 154685671) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is 6-[1-(1,3-benzodioxol-5-yl)ethyl]-4,5,7,8-tetrahydro-[1,2]oxazolo[4,5-d]azepine;ethane.
| Compound Name | 6-[1-(1,3-benzodioxol-5-yl)ethyl]-4,5,7,8-tetrahydro-[1,2]oxazolo[4,5-d]azepine;ethane |
|---|---|
| PubChem CID | 154685671 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | 6-[1-(1,3-benzodioxol-5-yl)ethyl]-4,5,7,8-tetrahydro-[1,2]oxazolo[4,5-d]azepine;ethane |
| SMILES | CC.CC(c1ccc2c(c1)OCO2)N1CCc2cnoc2CC1 |
| InChI | InChI=1S/C16H18N2O3.C2H6/c1-11(12-2-3-15-16(8-12)20-10-19-15)18-6-4-13-9-17-21-14(13)5-7-18;1-2/h2-3,8-9,11H,4-7,10H2,1H3;1-2H3 |
| InChIKey | NPGCEBAUDDENKW-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 47.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |