C25H26ClN3O4 — CID 118911706
2-[[5-chloro-2-(2-morpholin-4-ylethoxy)phenyl]methoxy]-N-pyridin-3-ylbenzamide (PubChem CID 118911706) has the molecular formula C25H26ClN3O4 and a molecular weight of 467.95 g/mol. Its IUPAC name is 2-[[5-chloro-2-(2-morpholin-4-ylethoxy)phenyl]methoxy]-N-pyridin-3-ylbenzamide.
| Compound Name | 2-[[5-chloro-2-(2-morpholin-4-ylethoxy)phenyl]methoxy]-N-pyridin-3-ylbenzamide |
|---|---|
| PubChem CID | 118911706 |
| Molecular Formula | C25H26ClN3O4 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-[[5-chloro-2-(2-morpholin-4-ylethoxy)phenyl]methoxy]-N-pyridin-3-ylbenzamide |
| SMILES | O=C(Nc1cccnc1)c1ccccc1OCc1cc(Cl)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C25H26ClN3O4/c26-20-7-8-23(32-15-12-29-10-13-31-14-11-29)19(16-20)18-33-24-6-2-1-5-22(24)25(30)28-21-4-3-9-27-17-21/h1-9,16-17H,10-15,18H2,(H,28,30) |
| InChIKey | ZEGJBBWWHKFFFU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |