C19H19Cl2N3O5 — CID 71527591
5-chloro-N-(2-chloro-4-nitrophenyl)-2-(2-morpholin-4-ylethoxy)benzamide (PubChem CID 71527591) has the molecular formula C19H19Cl2N3O5 and a molecular weight of 440.28 g/mol. Its IUPAC name is 5-chloro-N-(2-chloro-4-nitrophenyl)-2-(2-morpholin-4-ylethoxy)benzamide.
| Compound Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-(2-morpholin-4-ylethoxy)benzamide |
|---|---|
| PubChem CID | 71527591 |
| Molecular Formula | C19H19Cl2N3O5 |
| Molecular Weight | 440.28 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-(2-morpholin-4-ylethoxy)benzamide |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(Cl)ccc1OCCN1CCOCC1 |
| InChI | InChI=1S/C19H19Cl2N3O5/c20-13-1-4-18(29-10-7-23-5-8-28-9-6-23)15(11-13)19(25)22-17-3-2-14(24(26)27)12-16(17)21/h1-4,11-12H,5-10H2,(H,22,25) |
| InChIKey | CXEIYLWLMNAHNO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|