C18H17Cl2N3O5 — CID 178041049
[4-chloro-2-[(2-chloro-4-nitrophenyl)carbamoyl]phenyl] 2-amino-3-methylbutanoate (PubChem CID 178041049) has the molecular formula C18H17Cl2N3O5 and a molecular weight of 426.26 g/mol. Its IUPAC name is [4-chloro-2-[(2-chloro-4-nitrophenyl)carbamoyl]phenyl] 2-amino-3-methylbutanoate.
| Compound Name | [4-chloro-2-[(2-chloro-4-nitrophenyl)carbamoyl]phenyl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 178041049 |
| Molecular Formula | C18H17Cl2N3O5 |
| Molecular Weight | 426.26 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | [4-chloro-2-[(2-chloro-4-nitrophenyl)carbamoyl]phenyl] 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)Oc1ccc(Cl)cc1C(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C18H17Cl2N3O5/c1-9(2)16(21)18(25)28-15-6-3-10(19)7-12(15)17(24)22-14-5-4-11(23(26)27)8-13(14)20/h3-9,16H,21H2,1-2H3,(H,22,24) |
| InChIKey | HQUXJROQAAGRAU-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|