C19H19ClN4O6 — CID 163370552
[4-chloro-2-[(2-methoxy-4-nitrophenyl)carbamoyl]phenyl] piperazine-1-carboxylate (PubChem CID 163370552) has the molecular formula C19H19ClN4O6 and a molecular weight of 434.84 g/mol. Its IUPAC name is [4-chloro-2-[(2-methoxy-4-nitrophenyl)carbamoyl]phenyl] piperazine-1-carboxylate.
| Compound Name | [4-chloro-2-[(2-methoxy-4-nitrophenyl)carbamoyl]phenyl] piperazine-1-carboxylate |
|---|---|
| PubChem CID | 163370552 |
| Molecular Formula | C19H19ClN4O6 |
| Molecular Weight | 434.84 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | [4-chloro-2-[(2-methoxy-4-nitrophenyl)carbamoyl]phenyl] piperazine-1-carboxylate |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)c1cc(Cl)ccc1OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C19H19ClN4O6/c1-29-17-11-13(24(27)28)3-4-15(17)22-18(25)14-10-12(20)2-5-16(14)30-19(26)23-8-6-21-7-9-23/h2-5,10-11,21H,6-9H2,1H3,(H,22,25) |
| InChIKey | JVZOJZAQRPGVMB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 123.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.84 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|