C24H26Cl2N4O5 — CID 130230135
[4-chloro-2-[(2-chloro-4-nitrophenyl)carbamoyl]phenyl] 4-piperidin-1-ylpiperidine-1-carboxylate (PubChem CID 130230135) has the molecular formula C24H26Cl2N4O5 and a molecular weight of 521.40 g/mol. Its IUPAC name is [4-chloro-2-[(2-chloro-4-nitrophenyl)carbamoyl]phenyl] 4-piperidin-1-ylpiperidine-1-carboxylate.
| Compound Name | [4-chloro-2-[(2-chloro-4-nitrophenyl)carbamoyl]phenyl] 4-piperidin-1-ylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 130230135 |
| Molecular Formula | C24H26Cl2N4O5 |
| Molecular Weight | 521.40 g/mol |
| Exact Mass | 520.13 |
| IUPAC Name | [4-chloro-2-[(2-chloro-4-nitrophenyl)carbamoyl]phenyl] 4-piperidin-1-ylpiperidine-1-carboxylate |
| SMILES | O=C(Nc1ccc([N+](=O)[O-])cc1Cl)c1cc(Cl)ccc1OC(=O)N1CCC(N2CCCCC2)CC1 |
| InChI | InChI=1S/C24H26Cl2N4O5/c25-16-4-7-22(19(14-16)23(31)27-21-6-5-18(30(33)34)15-20(21)26)35-24(32)29-12-8-17(9-13-29)28-10-2-1-3-11-28/h4-7,14-15,17H,1-3,8-13H2,(H,27,31) |
| InChIKey | HINLIFMMBRFPJT-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.40 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|