C18H19N5O4 — CID 118914009
[(2R)-1-[[2-(4-cyano-2-ethylphenoxy)pyrimidin-5-yl]amino]-1-oxobutan-2-yl]carbamic acid (PubChem CID 118914009) has the molecular formula C18H19N5O4 and a molecular weight of 369.38 g/mol. Its IUPAC name is [(2R)-1-[[2-(4-cyano-2-ethylphenoxy)pyrimidin-5-yl]amino]-1-oxobutan-2-yl]carbamic acid.
| Compound Name | [(2R)-1-[[2-(4-cyano-2-ethylphenoxy)pyrimidin-5-yl]amino]-1-oxobutan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 118914009 |
| Molecular Formula | C18H19N5O4 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.14 |
| IUPAC Name | [(2R)-1-[[2-(4-cyano-2-ethylphenoxy)pyrimidin-5-yl]amino]-1-oxobutan-2-yl]carbamic acid |
| SMILES | CCc1cc(C#N)ccc1Oc1ncc(NC(=O)[C@@H](CC)NC(=O)O)cn1 |
| InChI | InChI=1S/C18H19N5O4/c1-3-12-7-11(8-19)5-6-15(12)27-17-20-9-13(10-21-17)22-16(24)14(4-2)23-18(25)26/h5-7,9-10,14,23H,3-4H2,1-2H3,(H,22,24)(H,25,26)/t14-/m1/s1 |
| InChIKey | DZQKNITUXBFHEV-CQSZACIVSA-N |
| XLogP | 2.69 |
| TPSA | 137.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |