C23H24N7O3S2- — CID 118914310
4-[2-(2-aminopyrimidin-5-yl)-7-methyl-6-[4-[2-(sulfinatoamino)ethyl]phenyl]thieno[3,2-d]pyrimidin-4-yl]morpholine (PubChem CID 118914310) has the molecular formula C23H24N7O3S2- and a molecular weight of 510.63 g/mol. Its IUPAC name is 4-[2-(2-aminopyrimidin-5-yl)-7-methyl-6-[4-[2-(sulfinatoamino)ethyl]phenyl]thieno[3,2-d]pyrimidin-4-yl]morpholine.
| Compound Name | 4-[2-(2-aminopyrimidin-5-yl)-7-methyl-6-[4-[2-(sulfinatoamino)ethyl]phenyl]thieno[3,2-d]pyrimidin-4-yl]morpholine |
|---|---|
| PubChem CID | 118914310 |
| Molecular Formula | C23H24N7O3S2- |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 4-[2-(2-aminopyrimidin-5-yl)-7-methyl-6-[4-[2-(sulfinatoamino)ethyl]phenyl]thieno[3,2-d]pyrimidin-4-yl]morpholine |
| SMILES | Cc1c(-c2ccc(CCNS(=O)[O-])cc2)sc2c(N3CCOCC3)nc(-c3cnc(N)nc3)nc12 |
| InChI | InChI=1S/C23H25N7O3S2/c1-14-18-20(34-19(14)16-4-2-15(3-5-16)6-7-27-35(31)32)22(30-8-10-33-11-9-30)29-21(28-18)17-12-25-23(24)26-13-17/h2-5,12-13,27H,6-11H2,1H3,(H,31,32)(H2,24,25,26)/p-1 |
| InChIKey | HXFTYAPDXJKEOC-UHFFFAOYSA-M |
| XLogP | 2.47 |
| TPSA | 142.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|