C19H21N7O3S — CID 56838921
ethyl 11-(2-aminopyrimidin-5-yl)-9-morpholin-4-yl-7-thia-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene-4-carboxylate (PubChem CID 56838921) has the molecular formula C19H21N7O3S and a molecular weight of 427.49 g/mol. Its IUPAC name is ethyl 11-(2-aminopyrimidin-5-yl)-9-morpholin-4-yl-7-thia-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene-4-carboxylate.
| Compound Name | ethyl 11-(2-aminopyrimidin-5-yl)-9-morpholin-4-yl-7-thia-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 56838921 |
| Molecular Formula | C19H21N7O3S |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | ethyl 11-(2-aminopyrimidin-5-yl)-9-morpholin-4-yl-7-thia-4,10,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),2(6),9,11-tetraene-4-carboxylate |
| SMILES | CCOC(=O)N1Cc2sc3c(N4CCOCC4)nc(-c4cnc(N)nc4)nc3c2C1 |
| InChI | InChI=1S/C19H21N7O3S/c1-2-29-19(27)26-9-12-13(10-26)30-15-14(12)23-16(11-7-21-18(20)22-8-11)24-17(15)25-3-5-28-6-4-25/h7-8H,2-6,9-10H2,1H3,(H2,20,21,22) |
| InChIKey | BUWIQYZAORJIAB-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 119.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |